application：(+)-2,2′-Isopropylidenebis[(4R)-4-phenyl-2-oxazoline] in the presence of copper iodide, can catalyze the asymmetric cyclopropanation reaction of phenyliodonium ylides with alkenes to form cyclopropane α-amino acid esters.C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals.
- Properties
- Weights
- Citation
| Name | (+)-2,2′-Isopropylidenebis[(4R)-4-phenyl-2-oxazoline] |
|---|---|
| CasNumber | 150529-93-4 |
| GradePurity | ≥96% |
| Formula | C21H22N2O2 |
| MolecularWeight | 334.41 |
| IupacName | |
| Smiles | CC(C)(C1=NC(CO1)C2=CC=CC=C2)C3=NC(CO3)C4=CC=CC=C4 |
| InchiKey | JTNVCJCSECAMLD-ROUUACIJSA-N |
| Inchi | 1S/C21H22N2O2/c1-21(2,19-22-17(13-24-19)15-9-5-3-6-10-15)20-23-18(14-25-20)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| Synonyms | (R,R)-Ph-box | AMY25577 | Oxazole, 2,2'-(1-methylethylidene)bis(4,5-dihydro-4-phenyl-, (4R,4'R)- | (... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| l115664-500mg | 500 | mg | 121 | 1000 | |
| l115664-100mg | 100 | mg | 23 | 1000 | |
| l115664-5g | 5 | g | 668 | 3 | |
| l115664-1g | 1 | g | 192 | 3 | |
| l115664-250mg | 250 | mg | 56 | 2 |
No citations available.
![(+)-2,2′-Isopropylidenebis[(4R)-4-benzyl-2-oxazoline]](/image/getimage/8a98c74f-207f-4fee-8bdc-916a6ccdfedd "(+)-2,2′-Isopropylidenebis[(4R)-4-benzyl-2-oxazoline]")
Reviews
There are no reviews yet.