Valuable building block for TADDOL chiral auxiliaries, dipyridine ligands, and threitolsApplication：+)-Dimethyl 2,3-O-isopropylidene-D-tartrate can be used as a starting material for the synthesis of:Deuterated 1-deoxy-D-xylose.C-terminal peptide -oxo-aldehydes using Fmoc solid-phase peptide synthesis methodology (SPPS).Bis-Weinreb amide, a key intermediate for the preparation of myo-inositol analog via ring-closing metathesis.
- Properties
- Weights
- Citation
| Name | (+)-Dimethyl 2,3-O-isopropylidene-D-tartrate |
|---|---|
| CasNumber | 37031-30-4 |
| GradePurity | ≥95%(GC) |
| Formula | C9H14O6 |
| MolecularWeight | 218.21 |
| IupacName | |
| Smiles | CC1(OC(C(O1)C(=O)OC)C(=O)OC)C |
| InchiKey | ROZOUYVVWUTPNG-WDSKDSINSA-N |
| Inchi | 1S/C9H14O6/c1-9(2)14-5(7(10)12-3)6(15-9)8(11)13-4/h5-6H,1-4H3/t5-,6-/m0/s1 |
| Synonyms | (4S,5S)-Dimethyl2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate | SCHEMBL10266772 | (4S,5S)-Dimethyl 2,... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| O133322-1g | 1 | g | 23 | 1 | |
| O133322-25g | 25 | g | 391 | 5 | |
| O133322-5g | 5 | g | 87 | 3 |
No citations available.
Reviews
There are no reviews yet.