It is an essential amino acid produced for medical, feed, and nutritional applications such as in the preparation of aspartame. It is applied as an antidepressant.
- Properties
- Weights
- Citation
| Name | N-Acetyl-L-phenylalanine |
|---|---|
| CasNumber | 2018-61-3 |
| GradePurity | ≥99% |
| Formula | C11H13NO3 |
| MolecularWeight | 207.23 |
| IupacName | |
| Smiles | CC(=O)NC(CC1=CC=CC=C1)C(=O)O |
| InchiKey | CBQJSKKFNMDLON-JTQLQIEISA-N |
| Inchi | 1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| Synonyms | 3-benzoyl-1-methyl-4-phenylpiperidin-4-ol | 5CR | Acid Green B | AKOS001051290 | AKOS015837745 | AC-... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| A100453-100g | 100 | g | 20 | 9 | |
| N422455-1ml | 1 | ml | 59 | 1 | |
| A100453-1g | 1 | g | 10 | 2 | |
| A100453-500g | 500 | g | 94 | 1 | |
| A100453-5g | 5 | g | 11 | 3 | |
| A100453-25g | 25 | g | 12 | 7 |
No citations available.
Reviews
There are no reviews yet.