Adenosine 5′-Monophosphate, Disodium Salt is a nucleotide that is widely distributed in nature. Adenosine 5′-Monophosphate, Disodium Salt is an activator of AMPK.A nucleotide involved in the reactions of cellular energy transfers.
- Properties
- Weights
- Citation
| Name | 5'-AMP-Na2 |
|---|---|
| CasNumber | 4578-31-8 |
| GradePurity | ≥99% |
| Formula | C10H12N5Na2O7P |
| MolecularWeight | 391.18 |
| IupacName | |
| Smiles | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)([O-])[O-])O)O)N.[Na+].[Na+] |
| InchiKey | QGXLVXZRPRRCRP-IDIVVRGQSA-L |
| Inchi | 1S/C10H14N5O7P.2Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);;/q;2*+1/p-2/t4-,6-,7-,10-;;/m1../s1 |
| Synonyms | Adenosine 5'-monophosphate disodium salt | UNII-T1WZ11DSRN | 5'-ADENYLIC ACID, SODIUM SALT (1:2) | A... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| A100357-500g | 500 | g | 180 | 1 | |
| A100357-25g | 25 | g | 28 | 2 | |
| A100357-5g | 5 | g | 10 | 1 | |
| A100357-100g | 100 | g | 55 | 1 |
No citations available.
Reviews
There are no reviews yet.