Other NotesStarting material for the synthesis of chiral building blocks; L-Ascorbic acid, review
- Properties
- Weights
- Citation
| Name | (+)-Sodium L-ascorbate |
|---|---|
| CasNumber | 134-03-2 |
| GradePurity | ≥99% |
| Formula | C6H7NaO6 |
| MolecularWeight | 198.11 |
| IupacName | |
| Smiles | [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] |
| InchiKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
| Inchi | 1S/C6H8O6.Na/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5+;/m0./s1 |
| Synonyms | L-Ascorbic acid, monosodium salt | sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| S421288-1ml | 1 | ml | 59 | 4 | |
| S105026-500g | 500 | g | 121 | 1 | |
| S105024-10g | 10 | g | 10 | 2 | |
| S431925-50g | 50 | g | 117 | 3 | |
| S105024-100g | 100 | g | 19 | 9 | |
| S431925-250g | 250 | g | 238 | 3 | |
| S105025-250mg | 250 | mg | 89 | 2 | |
| S105026-100g | 100 | g | 34 | 3 | |
| S105024-25g | 25 | g | 15 | 3 | |
| S105024-500g | 500 | g | 31 | 2 |
No citations available.
Reviews
There are no reviews yet.