Dietary fiber that enhances immune system function by stimulating natural killer (NK) cell activity.Application：Larch arabinogalactan, a biopolymer of plant origin, is an excellent dietary fiber that has been shown to increase the production of short-chain fatty acids, primarily butyrate and propionate, and reduce the production and absorption of ammonia. Larch arabinogalactan can stimulate the cytotoxicity of natural killer cells, enhance other functions of the immune system, and inhibit the metastasis of tumor cells to the liver
- Properties
- Weights
- Citation
| Name | (+)-Arabinogalactan from Larch Wood |
|---|---|
| CasNumber | 9036-66-2 |
| GradePurity | |
| Formula | [(C5H8O4)(C6H10O5)6]x |
| MolecularWeight | |
| IupacName | |
| Smiles | CC1C(C(C(C(O1)CO)O)OC2C(C(C(C(O2)COC3C(C(C(CO3)O)OC)O)O)OC)O)O |
| InchiKey | SATHPVQTSSUFFW-UHFFFAOYSA-N |
| Inchi | 1S/C20H36O14/c1-7-11(23)18(12(24)9(4-21)32-7)34-20-15(27)17(29-3)13(25)10(33-20)6-31-19-14(26)16(28-2)8(22)5-30-19/h7-27H,4-6H2,1-3H3 |
| Synonyms | [(C5H8O4)(C6H10O5)6]x |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| A304929-5g | 5 | g | 16 | 1 | |
| A304929-1g | 1 | g | 10 | 2 | |
| A304929-500g | 500 | g | 644 | 1 | |
| A304929-100g | 100 | g | 190 | 1 | |
| A304929-25g | 25 | g | 60 | 1 |
No citations available.
Reviews
There are no reviews yet.