(-)-trans-Caryophyllene, a sesquiterpene, is the major constituent in the essential oil of Mentha longifolia and Commiphora gileadensis. It shows anti-inflammatory, local anaesthetic and antifungal properties. (-)-trans-Caryophyllene also shows potent cytotoxic activity.
- Properties
- Weights
- Citation
| Name | (-)-trans-Caryophyllene |
|---|---|
| CasNumber | 87-44-5 |
| GradePurity | ≥98% |
| Formula | C15H24 |
| MolecularWeight | 204.35 |
| IupacName | |
| Smiles | CC1=CCCC(=C)C2CC(C2CC1)(C)C |
| InchiKey | NPNUFJAVOOONJE-GFUGXAQUSA-N |
| Inchi | 1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6+/t13-,14-/m1/s1 |
| Synonyms | (?)-trans-Caryophyllene | (1R,4E,9S)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene | (-)-... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| T334030-100ml | 100 | ml | 30 | 5 | |
| T334030-500ml | 500 | ml | 64 | 1 | |
| T334030-5ml | 5 | ml | 10 | 4 | |
| T334030-25ml | 25 | ml | 12 | 4 | |
| T426611-1ml | 1 | ml | 59 | 1 | |
| T334030-1ml | 1 | ml | 10 | 4 |
No citations available.
Reviews
There are no reviews yet.