(-)-Eburnamonine is a vasodilator and cerebral metabolic stimulant with antihypoxic effects.
- Properties
- Weights
- Citation
| Name | (-)-Eburnamonine |
|---|---|
| CasNumber | 4880-88-0 |
| GradePurity | ≥99% |
| Formula | C19H22N2O |
| MolecularWeight | 294.39 |
| IupacName | |
| Smiles | CCC12CCCN3C1C4=C(CC3)C5=CC=CC=C5N4C(=O)C2 |
| InchiKey | WYJAPUKIYAZSEM-MOPGFXCFSA-N |
| Inchi | 1S/C19H22N2O/c1-2-19-9-5-10-20-11-8-14-13-6-3-4-7-15(13)21(16(22)12-19)17(14)18(19)20/h3-4,6-7,18H,2,5,8-12H2,1H3/t18-,19+/m1/s1 |
| Synonyms | HY-B1180 | NCIStruc2_000870 | 2-((6-(Benzylamino)-9-methyl-9H-purin-2-yl)amino)ethanol | 2-Methyldip... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| E348350-250mg | 250 | mg | 149 | 2 | |
| E348350-1g | 1 | g | 451 | 2 | |
| E348350-100mg | 100 | mg | 83 | 3 |
No citations available.
Reviews
There are no reviews yet.