(+)-Blebbistatin is the inactive enantiomer of (–)-Blebbistatin. (–)-Blebbistatin is a selective inhibitor of myosin II ATPase.
- Properties
- Weights
- Citation
| Name | (+)-Blebbistatin |
|---|---|
| CasNumber | 1177356-70-5 |
| GradePurity | ≥99%(HPLC) |
| Formula | C18H16N2O2 |
| MolecularWeight | 292.34 |
| IupacName | |
| Smiles | CC1=CC2=C(C=C1)N=C3C(C2=O)(CCN3C4=CC=CC=C4)O |
| InchiKey | LZAXPYOBKSJSEX-SFHVURJKSA-N |
| Inchi | 1S/C18H16N2O2/c1-12-7-8-15-14(11-12)16(21)18(22)9-10-20(17(18)19-15)13-5-3-2-4-6-13/h2-8,11,22H,9-10H2,1H3/t18-/m0/s1 |
| Synonyms | (3aR)-3a-hydroxy-6-methyl-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one | Blebbistatin, (+)- | CH... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| B1493999-1ml | 1 | ml | 84 | 1000 | |
| R287278-5mg | 5 | mg | 182 | 2 | |
| R287278-50mg | 50 | mg | 1023 | 2 | |
| R287278-10mg | 10 | mg | 252 | 2 | |
| R287278-100mg | 100 | mg | 1664 | 2 | |
| R287278-25mg | 25 | mg | 567 | 2 |
No citations available.
Reviews
There are no reviews yet.