(+)-Cloprostenol is a prostaglandin F2α (PGF2α) analogue, and shows selective agonistic activity at the prostaglandin receptor .
- Properties
- Weights
- Citation
| Name | (+)-Cloprostenol |
|---|---|
| CasNumber | 54276-21-0 |
| GradePurity | ≥97% |
| Formula | C22H29ClO6 |
| MolecularWeight | 424.9 |
| IupacName | |
| Smiles | C1C(C(C(C1O)C=CC(COC2=CC(=CC=C2)Cl)O)CC=CCCCC(=O)O)O |
| InchiKey | VJGGHXVGBSZVMZ-QIZQQNKQSA-N |
| Inchi | 1S/C22H29ClO6/c23-15-6-5-7-17(12-15)29-14-16(24)10-11-19-18(20(25)13-21(19)26)8-3-1-2-4-9-22(27)28/h1,3,5-7,10-12,16,18-21,24-26H,2,4,8-9,13-14H2,(H,27,28)/b3-1-,11-10+/t16-,18-,19-,20+,21-/m1/s1 |
| Synonyms | 5-HEPTENOIC ACID, 7-((1R,2R,3R,5S)-2-((1E,3S)-4-(3-CHLOROPHENOXY)-3-HYDROXY-1-BUTEN-1-Y))-3,5-DIHYDR... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| C347980-5mg | 5 | mg | 249 | 3 | |
| C347980-25mg | 25 | mg | 926 | 2 | |
| C1493924-1ml | 1 | ml | 186 | 1000 | |
| C347980-1mg | 1 | mg | 74 | 3 | |
| C347980-100mg | 100 | mg | 2649 | 2 |
No citations available.
Reviews
There are no reviews yet.