(+)-nootkatone, a bicyclic conjugated sesquiterpene ketone with a grapefruit-like flavor, is commonly used in fragrance, food, cosmetics and pharmaceutical industry. It can be synthesized from (+)-valencene via biotransformation. (+)-nootkatone is the active ingredient responsible for the antiplatelet effect of Cyperus rotundus, a well-known oriental traditional medicine.
- Properties
- Weights
- Citation
| Name | (+)-Nootkatone |
|---|---|
| CasNumber | 4674-50-4 |
| GradePurity | ≥97%(GC) |
| Formula | C15H22O |
| MolecularWeight | 218.34 |
| IupacName | |
| Smiles | CC1CC(=O)C=C2C1(CC(CC2)C(=C)C)C |
| InchiKey | WTOYNNBCKUYIKC-JMSVASOKSA-N |
| Inchi | 1S/C15H22O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11-12H,1,5-7,9H2,2-4H3/t11-,12-,15+/m1/s1 |
| Synonyms | (+)-Nootkatone, technical, >=85% (GC) | Nootkanone | UNII-3K3OKV2A5A | 4Betah,5alpha-eremophila-1(10... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| N159076-25g | 25 | g | 582 | 3 | |
| N424097-1ml | 1 | ml | 55 | 1 | |
| N159076-1g | 1 | g | 26 | 3 | |
| N159076-5g | 5 | g | 122 | 3 |
No citations available.
Reviews
There are no reviews yet.