(+)-cis-Abienol functions as a potential inhibitor of certain enzymes involved in cellular processes. It interacts with specific molecular targets, disrupting their normal activity and potentially influencing the regulation of biochemical pathways. By binding to specific sites on these enzymes, (+)-cis-Abienol may interfere with their normal function, leading to potential alterations in cellular processes. Its mechanism of action involves the disruption of molecular interactions and the potential inhibition of enzymatic activity, which could have implications for the regulation of biological pathways. (+)-Cis-Abienol′s interaction with cellular components may provide insights into the underlying mechanisms of certain biochemical processes, contributing to the understanding of fundamental cellular functions.Product Application：(+)-cis-Abienol is used in the synthesis of diols as well as in products requiring flavors or fragrances.
- Properties
- Weights
- Citation
| Name | (+)-cis-Abienol |
|---|---|
| CasNumber | 17990-16-8 |
| GradePurity | ≥95% |
| Formula | C20H34O |
| MolecularWeight | 290.48 |
| IupacName | |
| Smiles | CC(=CCC1C2(CCCC(C2CCC1(C)O)(C)C)C)C=C |
| InchiKey | ZAZVCYBIABTSJR-SZAPHMHZSA-N |
| Inchi | 1S/C20H34O/c1-7-15(2)9-10-17-19(5)13-8-12-18(3,4)16(19)11-14-20(17,6)21/h7,9,16-17,21H,1,8,10-14H2,2-6H3/b15-9-/t16-,17+,19-,20+/m0/s1 |
| Synonyms | (1R,2R,4aS,8aS)-2,5,5,8a-tetramethyl-1-[(2Z)-3-methylpenta-2,4-dienyl]-3,4,4a,6,7,8-hexahydro-1H-nap... |
| CidNumber |
| SKU | Size | Unit | Price $ | Stock | |
|---|---|---|---|---|---|
| C358146-250mg | 250 | mg | 2026 | 1 | |
| C358146-100mg | 100 | mg | 880 | 1 | |
| C358146-25mg | 25 | mg | 344 | 1 |
No citations available.
Reviews
There are no reviews yet.